C22H22ClNO2 — CID 169468652
tert-butyl N-[3-(10-chloroanthracen-9-yl)prop-2-enyl]carbamate (PubChem CID 169468652) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is tert-butyl N-[3-(10-chloroanthracen-9-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(10-chloroanthracen-9-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468652 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | tert-butyl N-[3-(10-chloroanthracen-9-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1c2ccccc2c(Cl)c2ccccc12 |
| InChI | InChI=1S/C22H22ClNO2/c1-22(2,3)26-21(25)24-14-8-13-15-16-9-4-6-11-18(16)20(23)19-12-7-5-10-17(15)19/h4-13H,14H2,1-3H3,(H,24,25) |
| InChIKey | FHKALNIBOICULA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|