C14H15F4NO2 — CID 169467729
tert-butyl N-[3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]carbamate (PubChem CID 169467729) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467729 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | tert-butyl N-[3-(2,3,5,6-tetrafluorophenyl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H15F4NO2/c1-14(2,3)21-13(20)19-6-4-5-8-11(17)9(15)7-10(16)12(8)18/h4-5,7H,6H2,1-3H3,(H,19,20) |
| InChIKey | FVHMSSQIISSXON-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|