C17H23ClN2O2 — CID 123208430
2-chloro-4-(3,3-dimethylbutyl)-3-nitroquinoline;ethane (PubChem CID 123208430) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-4-(3,3-dimethylbutyl)-3-nitroquinoline;ethane.
| Compound Name | 2-chloro-4-(3,3-dimethylbutyl)-3-nitroquinoline;ethane |
|---|---|
| PubChem CID | 123208430 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-chloro-4-(3,3-dimethylbutyl)-3-nitroquinoline;ethane |
| SMILES | CC.CC(C)(C)CCc1c([N+](=O)[O-])c(Cl)nc2ccccc12 |
| InChI | InChI=1S/C15H17ClN2O2.C2H6/c1-15(2,3)9-8-11-10-6-4-5-7-12(10)17-14(16)13(11)18(19)20;1-2/h4-7H,8-9H2,1-3H3;1-2H3 |
| InChIKey | PIFXIHFAAYRJBN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|