C26H36N4O5 — CID 90805824
tert-butyl N-[2-[(3-nitroquinolin-4-yl)amino]ethyl]carbamate;ethane;methoxymethylbenzene (PubChem CID 90805824) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-nitroquinolin-4-yl)amino]ethyl]carbamate;ethane;methoxymethylbenzene.
| Compound Name | tert-butyl N-[2-[(3-nitroquinolin-4-yl)amino]ethyl]carbamate;ethane;methoxymethylbenzene |
|---|---|
| PubChem CID | 90805824 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | tert-butyl N-[2-[(3-nitroquinolin-4-yl)amino]ethyl]carbamate;ethane;methoxymethylbenzene |
| SMILES | CC.CC(C)(C)OC(=O)NCCNc1c([N+](=O)[O-])cnc2ccccc12.COCc1ccccc1 |
| InChI | InChI=1S/C16H20N4O4.C8H10O.C2H6/c1-16(2,3)24-15(21)18-9-8-17-14-11-6-4-5-7-12(11)19-10-13(14)20(22)23;1-9-7-8-5-3-2-4-6-8;1-2/h4-7,10H,8-9H2,1-3H3,(H,17,19)(H,18,21);2-6H,7H2,1H3;1-2H3 |
| InChIKey | ILZJKAZKDKGSNH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|