C23H36N4O5Si — CID 87214854
tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[3-[(3-nitroquinolin-4-yl)amino]propyl]carbamate (PubChem CID 87214854) has the molecular formula C23H36N4O5Si and a molecular weight of 476.65 g/mol. Its IUPAC name is tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[3-[(3-nitroquinolin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[3-[(3-nitroquinolin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 87214854 |
| Molecular Formula | C23H36N4O5Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | tert-butyl N-[tert-butyl(dimethyl)silyl]oxy-N-[3-[(3-nitroquinolin-4-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCNc1c([N+](=O)[O-])cnc2ccccc12)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H36N4O5Si/c1-22(2,3)31-21(28)26(32-33(7,8)23(4,5)6)15-11-14-24-20-17-12-9-10-13-18(17)25-16-19(20)27(29)30/h9-10,12-13,16H,11,14-15H2,1-8H3,(H,24,25) |
| InChIKey | XBEBHQDCIZIAQA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|