C21H32N4O5Si — CID 69192302
[5-[tert-butyl(dimethyl)silyl]oxy-4-[(3-nitroquinolin-4-yl)amino]pentyl]carbamic acid (PubChem CID 69192302) has the molecular formula C21H32N4O5Si and a molecular weight of 448.60 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-4-[(3-nitroquinolin-4-yl)amino]pentyl]carbamic acid.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-[(3-nitroquinolin-4-yl)amino]pentyl]carbamic acid |
|---|---|
| PubChem CID | 69192302 |
| Molecular Formula | C21H32N4O5Si |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-4-[(3-nitroquinolin-4-yl)amino]pentyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CCCNC(=O)O)Nc1c([N+](=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C21H32N4O5Si/c1-21(2,3)31(4,5)30-14-15(9-8-12-22-20(26)27)24-19-16-10-6-7-11-17(16)23-13-18(19)25(28)29/h6-7,10-11,13,15,22H,8-9,12,14H2,1-5H3,(H,23,24)(H,26,27) |
| InChIKey | JRCJDODIFAFYAZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|