C21H23N3O3 — CID 155389083
4-[(2R)-2-[(3-nitroquinolin-4-yl)amino]hexyl]phenol (PubChem CID 155389083) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[(2R)-2-[(3-nitroquinolin-4-yl)amino]hexyl]phenol.
| Compound Name | 4-[(2R)-2-[(3-nitroquinolin-4-yl)amino]hexyl]phenol |
|---|---|
| PubChem CID | 155389083 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[(2R)-2-[(3-nitroquinolin-4-yl)amino]hexyl]phenol |
| SMILES | CCCC[C@H](Cc1ccc(O)cc1)Nc1c([N+](=O)[O-])cnc2ccccc12 |
| InChI | InChI=1S/C21H23N3O3/c1-2-3-6-16(13-15-9-11-17(25)12-10-15)23-21-18-7-4-5-8-19(18)22-14-20(21)24(26)27/h4-5,7-12,14,16,25H,2-3,6,13H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | MCWIUTFWQZGQRZ-MRXNPFEDSA-N |
| XLogP | 5.06 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|