C15H25BrN2O4Si — CID 168863395
(2S)-2-(2-bromo-6-nitroanilino)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol (PubChem CID 168863395) has the molecular formula C15H25BrN2O4Si and a molecular weight of 405.37 g/mol. Its IUPAC name is (2S)-2-(2-bromo-6-nitroanilino)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol.
| Compound Name | (2S)-2-(2-bromo-6-nitroanilino)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 168863395 |
| Molecular Formula | C15H25BrN2O4Si |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2S)-2-(2-bromo-6-nitroanilino)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CO)Nc1c(Br)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25BrN2O4Si/c1-15(2,3)23(4,5)22-10-11(9-19)17-14-12(16)7-6-8-13(14)18(20)21/h6-8,11,17,19H,9-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | PFDNFLCATSSHNR-NSHDSACASA-N |
| XLogP | 4.15 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|