C15H25NO6SSi — CID 140809704
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrophenyl]methyl methanesulfonate (PubChem CID 140809704) has the molecular formula C15H25NO6SSi and a molecular weight of 375.52 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrophenyl]methyl methanesulfonate.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrophenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 140809704 |
| Molecular Formula | C15H25NO6SSi |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-nitrophenyl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc([N+](=O)[O-])c1COS(C)(=O)=O |
| InChI | InChI=1S/C15H25NO6SSi/c1-15(2,3)24(5,6)22-10-12-8-7-9-14(16(17)18)13(12)11-21-23(4,19)20/h7-9H,10-11H2,1-6H3 |
| InChIKey | YYVMZLBBTFRVOV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|