C27H45NO4SSi2 — CID 175702586
N-[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-methylbenzenesulfonamide (PubChem CID 175702586) has the molecular formula C27H45NO4SSi2 and a molecular weight of 535.90 g/mol. Its IUPAC name is N-[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 175702586 |
| Molecular Formula | C27H45NO4SSi2 |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | N-[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1c(CO[Si](C)(C)C(C)(C)C)cccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H45NO4SSi2/c1-21-15-12-13-18-24(21)33(29,30)28-25-22(19-31-34(8,9)26(2,3)4)16-14-17-23(25)20-32-35(10,11)27(5,6)7/h12-18,28H,19-20H2,1-11H3 |
| InChIKey | WCKSYJQADBUQJK-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|