C17H29NO3Si — CID 58105215
ethyl 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]propanoate (PubChem CID 58105215) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is ethyl 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]propanoate.
| Compound Name | ethyl 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 58105215 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ethyl 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1cccc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C17H29NO3Si/c1-7-20-16(19)12-11-14-9-8-10-15(18-14)13-21-22(5,6)17(2,3)4/h8-10H,7,11-13H2,1-6H3 |
| InChIKey | ZAAFAGJHRBSLQW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|