C24H34O4Si — CID 11304558
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]propanoate (PubChem CID 11304558) has the molecular formula C24H34O4Si and a molecular weight of 414.62 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]propanoate.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]propanoate |
|---|---|
| PubChem CID | 11304558 |
| Molecular Formula | C24H34O4Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2ccccc2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C24H34O4Si/c1-7-26-23(25)16-14-19-13-15-21(27-18-20-11-9-8-10-12-20)22(17-19)28-29(5,6)24(2,3)4/h8-13,15,17H,7,14,16,18H2,1-6H3 |
| InChIKey | VRZBCOVNVDOHHY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|