C31H40O5Si — CID 24823856
3-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]-4-phenylmethoxyphenyl]propanoic acid (PubChem CID 24823856) has the molecular formula C31H40O5Si and a molecular weight of 520.74 g/mol. Its IUPAC name is 3-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]-4-phenylmethoxyphenyl]propanoic acid.
| Compound Name | 3-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]-4-phenylmethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 24823856 |
| Molecular Formula | C31H40O5Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 3-[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]-4-phenylmethoxyphenyl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1ccc(Oc2cc(CCC(=O)O)ccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H40O5Si/c1-31(2,3)37(4,5)35-21-9-12-24-13-17-27(18-14-24)36-29-22-25(16-20-30(32)33)15-19-28(29)34-23-26-10-7-6-8-11-26/h6-8,10-11,13-15,17-19,22H,9,12,16,20-21,23H2,1-5H3,(H,32,33) |
| InChIKey | YAFVJJVWZIXLRZ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|