C18H28O4Si — CID 68533653
(E)-3-[3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]prop-2-enoic acid (PubChem CID 68533653) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is (E)-3-[3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 68533653 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (E)-3-[3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenoxy]prop-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1cccc(O/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C18H28O4Si/c1-18(2,3)23(4,5)22-12-7-9-15-8-6-10-16(14-15)21-13-11-17(19)20/h6,8,10-11,13-14H,7,9,12H2,1-5H3,(H,19,20)/b13-11+ |
| InChIKey | PZWKIHWGDVKBRE-ACCUITESSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|