C20H37NO2Si — CID 67316685
3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propan-1-amine (PubChem CID 67316685) has the molecular formula C20H37NO2Si and a molecular weight of 351.61 g/mol. Its IUPAC name is 3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propan-1-amine.
| Compound Name | 3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 67316685 |
| Molecular Formula | C20H37NO2Si |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCOc1cccc(CCCN)c1 |
| InChI | InChI=1S/C20H37NO2Si/c1-20(2,3)24(4,5)23-16-8-6-7-15-22-19-13-9-11-18(17-19)12-10-14-21/h9,11,13,17H,6-8,10,12,14-16,21H2,1-5H3 |
| InChIKey | VKDFLGZSAKLVHN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|