C21H35N3O4Si — CID 10364901
methyl 2-azido-3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propanoate (PubChem CID 10364901) has the molecular formula C21H35N3O4Si and a molecular weight of 421.61 g/mol. Its IUPAC name is methyl 2-azido-3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propanoate.
| Compound Name | methyl 2-azido-3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10364901 |
| Molecular Formula | C21H35N3O4Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | methyl 2-azido-3-[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1cccc(OCCCCCO[Si](C)(C)C(C)(C)C)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C21H35N3O4Si/c1-21(2,3)29(5,6)28-14-9-7-8-13-27-18-12-10-11-17(15-18)16-19(23-24-22)20(25)26-4/h10-12,15,19H,7-9,13-14,16H2,1-6H3 |
| InChIKey | CSFADJOGCVZSFQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|