C17H29N3O4Si — CID 90032368
(2S,3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxyphenoxy)butan-2-ol (PubChem CID 90032368) has the molecular formula C17H29N3O4Si and a molecular weight of 367.52 g/mol. Its IUPAC name is (2S,3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxyphenoxy)butan-2-ol.
| Compound Name | (2S,3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxyphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 90032368 |
| Molecular Formula | C17H29N3O4Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2S,3S)-3-azido-4-[tert-butyl(dimethyl)silyl]oxy-1-(3-methoxyphenoxy)butan-2-ol |
| SMILES | COc1cccc(OC[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)N=[N+]=[N-])c1 |
| InChI | InChI=1S/C17H29N3O4Si/c1-17(2,3)25(5,6)24-11-15(19-20-18)16(21)12-23-14-9-7-8-13(10-14)22-4/h7-10,15-16,21H,11-12H2,1-6H3/t15-,16+/m0/s1 |
| InChIKey | MHDYLMNQXFMTJZ-JKSUJKDBSA-N |
| XLogP | 4.14 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|