C16H27N3O3Si — CID 10664705
(1R,2R)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)propan-2-ol (PubChem CID 10664705) has the molecular formula C16H27N3O3Si and a molecular weight of 337.50 g/mol. Its IUPAC name is (1R,2R)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)propan-2-ol.
| Compound Name | (1R,2R)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 10664705 |
| Molecular Formula | C16H27N3O3Si |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (1R,2R)-1-azido-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc([C@@H](N=[N+]=[N-])[C@@H](O)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H27N3O3Si/c1-16(2,3)23(5,6)22-11-14(20)15(18-19-17)12-7-9-13(21-4)10-8-12/h7-10,14-15,20H,11H2,1-6H3/t14-,15+/m0/s1 |
| InChIKey | RAZPJEQCCHTQQH-LSDHHAIUSA-N |
| XLogP | 4.43 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|