C11H12BrN3O3 — CID 101406820
methyl (2S,3S)-3-azido-2-bromo-3-(4-methoxyphenyl)propanoate (PubChem CID 101406820) has the molecular formula C11H12BrN3O3 and a molecular weight of 314.14 g/mol. Its IUPAC name is methyl (2S,3S)-3-azido-2-bromo-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S,3S)-3-azido-2-bromo-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 101406820 |
| Molecular Formula | C11H12BrN3O3 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | methyl (2S,3S)-3-azido-2-bromo-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Br)[C@@H](N=[N+]=[N-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H12BrN3O3/c1-17-8-5-3-7(4-6-8)10(14-15-13)9(12)11(16)18-2/h3-6,9-10H,1-2H3/t9-,10-/m0/s1 |
| InChIKey | WYTSVZBVWOBHOY-UWVGGRQHSA-N |
| XLogP | 2.98 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|