C12H14BrN3O4 — CID 101406810
methyl (2R,3R)-3-azido-2-bromo-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 101406810) has the molecular formula C12H14BrN3O4 and a molecular weight of 344.17 g/mol. Its IUPAC name is methyl (2R,3R)-3-azido-2-bromo-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl (2R,3R)-3-azido-2-bromo-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 101406810 |
| Molecular Formula | C12H14BrN3O4 |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | methyl (2R,3R)-3-azido-2-bromo-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Br)[C@H](N=[N+]=[N-])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H14BrN3O4/c1-18-8-5-4-7(6-9(8)19-2)11(15-16-14)10(13)12(17)20-3/h4-6,10-11H,1-3H3/t10-,11-/m1/s1 |
| InChIKey | DKWSDLYUOLHJKD-GHMZBOCLSA-N |
| XLogP | 2.99 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|