C15H19NO8 — CID 3123293
dimethyl 2-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]propanedioate (PubChem CID 3123293) has the molecular formula C15H19NO8 and a molecular weight of 341.32 g/mol. Its IUPAC name is dimethyl 2-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]propanedioate.
| Compound Name | dimethyl 2-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]propanedioate |
|---|---|
| PubChem CID | 3123293 |
| Molecular Formula | C15H19NO8 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | dimethyl 2-[1-(3,4-dimethoxyphenyl)-2-nitroethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(C[N+](=O)[O-])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H19NO8/c1-21-11-6-5-9(7-12(11)22-2)10(8-16(19)20)13(14(17)23-3)15(18)24-4/h5-7,10,13H,8H2,1-4H3 |
| InChIKey | OFXAFACDMSDAKU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|