C14H17NO5 — CID 71812882
3-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]pentane-2,4-dione (PubChem CID 71812882) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]pentane-2,4-dione.
| Compound Name | 3-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 71812882 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]pentane-2,4-dione |
| SMILES | COc1ccc([C@@H](C[N+](=O)[O-])C(C(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C14H17NO5/c1-9(16)14(10(2)17)13(8-15(18)19)11-4-6-12(20-3)7-5-11/h4-7,13-14H,8H2,1-3H3/t13-/m1/s1 |
| InChIKey | HRTJQFPRESHFBW-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|