C13H14N2O6 — CID 102494136
3-[2-nitro-1-(3-nitrophenyl)ethyl]pentane-2,4-dione (PubChem CID 102494136) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is 3-[2-nitro-1-(3-nitrophenyl)ethyl]pentane-2,4-dione.
| Compound Name | 3-[2-nitro-1-(3-nitrophenyl)ethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 102494136 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[2-nitro-1-(3-nitrophenyl)ethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(C[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O6/c1-8(16)13(9(2)17)12(7-14(18)19)10-4-3-5-11(6-10)15(20)21/h3-6,12-13H,7H2,1-2H3 |
| InChIKey | XSUURMURYFZIDY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|