C17H19NO8 — CID 26975254
dimethyl (2S,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate (PubChem CID 26975254) has the molecular formula C17H19NO8 and a molecular weight of 365.34 g/mol. Its IUPAC name is dimethyl (2S,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate.
| Compound Name | dimethyl (2S,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate |
|---|---|
| PubChem CID | 26975254 |
| Molecular Formula | C17H19NO8 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | dimethyl (2S,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate |
| SMILES | COC(=O)[C@@H](C(C)=O)C(c1cccc([N+](=O)[O-])c1)[C@@H](C(C)=O)C(=O)OC |
| InChI | InChI=1S/C17H19NO8/c1-9(19)13(16(21)25-3)15(14(10(2)20)17(22)26-4)11-6-5-7-12(8-11)18(23)24/h5-8,13-15H,1-4H3/t13-,14+,15? |
| InChIKey | NRZGJFOHXKPBOS-YIONKMFJSA-N |
| XLogP | 1.43 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|