C21H27NO8 — CID 40532087
dipropan-2-yl (2R,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate (PubChem CID 40532087) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is dipropan-2-yl (2R,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate.
| Compound Name | dipropan-2-yl (2R,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate |
|---|---|
| PubChem CID | 40532087 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | dipropan-2-yl (2R,4R)-2,4-diacetyl-3-(3-nitrophenyl)pentanedioate |
| SMILES | CC(=O)[C@H](C(=O)OC(C)C)C(c1cccc([N+](=O)[O-])c1)[C@H](C(C)=O)C(=O)OC(C)C |
| InChI | InChI=1S/C21H27NO8/c1-11(2)29-20(25)17(13(5)23)19(15-8-7-9-16(10-15)22(27)28)18(14(6)24)21(26)30-12(3)4/h7-12,17-19H,1-6H3/t17-,18-/m0/s1 |
| InChIKey | DPHUMJWVOASNEI-ROUUACIJSA-N |
| XLogP | 2.99 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|