C39H59NO12 — CID 21401549
tetrahexyl 3-(3-nitrophenyl)-1,5-dioxopentane-1,2,4,5-tetracarboxylate (PubChem CID 21401549) has the molecular formula C39H59NO12 and a molecular weight of 733.90 g/mol. Its IUPAC name is tetrahexyl 3-(3-nitrophenyl)-1,5-dioxopentane-1,2,4,5-tetracarboxylate.
| Compound Name | tetrahexyl 3-(3-nitrophenyl)-1,5-dioxopentane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 21401549 |
| Molecular Formula | C39H59NO12 |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.40 |
| IUPAC Name | tetrahexyl 3-(3-nitrophenyl)-1,5-dioxopentane-1,2,4,5-tetracarboxylate |
| SMILES | CCCCCCOC(=O)C(=O)C(C(=O)OCCCCCC)C(c1cccc([N+](=O)[O-])c1)C(C(=O)OCCCCCC)C(=O)C(=O)OCCCCCC |
| InChI | InChI=1S/C39H59NO12/c1-5-9-13-17-24-49-36(43)32(34(41)38(45)51-26-19-15-11-7-3)31(29-22-21-23-30(28-29)40(47)48)33(37(44)50-25-18-14-10-6-2)35(42)39(46)52-27-20-16-12-8-4/h21-23,28,31-33H,5-20,24-27H2,1-4H3 |
| InChIKey | ASDFUHBVNSORFA-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 182.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|