C26H27NO4 — CID 54769690
(2R,3R)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one (PubChem CID 54769690) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2R,3R)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one.
| Compound Name | (2R,3R)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one |
|---|---|
| PubChem CID | 54769690 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2R,3R)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one |
| SMILES | CC[C@@H](c1ccccc1)[C@@H](C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-3-23(19-10-6-4-7-11-19)25(26(28)21-12-8-5-9-13-21)24(18-27(29)30)20-14-16-22(31-2)17-15-20/h4-17,23-25H,3,18H2,1-2H3/t23-,24+,25+/m0/s1 |
| InChIKey | WZFGEJZSTFXGQD-ISJGIBHGSA-N |
| XLogP | 5.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|