C18H18FNO4 — CID 44604177
methyl (3R,4S)-4-(4-fluorophenyl)-5-nitro-3-phenylpentanoate (PubChem CID 44604177) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is methyl (3R,4S)-4-(4-fluorophenyl)-5-nitro-3-phenylpentanoate.
| Compound Name | methyl (3R,4S)-4-(4-fluorophenyl)-5-nitro-3-phenylpentanoate |
|---|---|
| PubChem CID | 44604177 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl (3R,4S)-4-(4-fluorophenyl)-5-nitro-3-phenylpentanoate |
| SMILES | COC(=O)C[C@@H](c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNO4/c1-24-18(21)11-16(13-5-3-2-4-6-13)17(12-20(22)23)14-7-9-15(19)10-8-14/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | YZXXYUMXEWHNBV-DLBZAZTESA-N |
| XLogP | 3.53 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|