C25H22O4 — CID 134842570
methyl (3S)-4-benzoyl-5-oxo-3,5-diphenylpentanoate (PubChem CID 134842570) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl (3S)-4-benzoyl-5-oxo-3,5-diphenylpentanoate.
| Compound Name | methyl (3S)-4-benzoyl-5-oxo-3,5-diphenylpentanoate |
|---|---|
| PubChem CID | 134842570 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | methyl (3S)-4-benzoyl-5-oxo-3,5-diphenylpentanoate |
| SMILES | COC(=O)C[C@H](c1ccccc1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22O4/c1-29-22(26)17-21(18-11-5-2-6-12-18)23(24(27)19-13-7-3-8-14-19)25(28)20-15-9-4-10-16-20/h2-16,21,23H,17H2,1H3/t21-/m1/s1 |
| InChIKey | OZGUYDSMVLSCPL-OAQYLSRUSA-N |
| XLogP | 4.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|