C19H23NO3Si — CID 71546472
(2S,3R)-4-nitro-2,3-diphenyl-1-trimethylsilylbutan-1-one (PubChem CID 71546472) has the molecular formula C19H23NO3Si and a molecular weight of 341.48 g/mol. Its IUPAC name is (2S,3R)-4-nitro-2,3-diphenyl-1-trimethylsilylbutan-1-one.
| Compound Name | (2S,3R)-4-nitro-2,3-diphenyl-1-trimethylsilylbutan-1-one |
|---|---|
| PubChem CID | 71546472 |
| Molecular Formula | C19H23NO3Si |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S,3R)-4-nitro-2,3-diphenyl-1-trimethylsilylbutan-1-one |
| SMILES | C[Si](C)(C)C(=O)[C@H](c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H23NO3Si/c1-24(2,3)19(21)18(16-12-8-5-9-13-16)17(14-20(22)23)15-10-6-4-7-11-15/h4-13,17-18H,14H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | MQEYPAYWWWGPKE-ZWKOTPCHSA-N |
| XLogP | 4.28 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|