C13H14NO6- — CID 23070417
2-ethoxycarbonyl-4-nitro-3-phenylbutanoate (PubChem CID 23070417) has the molecular formula C13H14NO6- and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-nitro-3-phenylbutanoate.
| Compound Name | 2-ethoxycarbonyl-4-nitro-3-phenylbutanoate |
|---|---|
| PubChem CID | 23070417 |
| Molecular Formula | C13H14NO6- |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-ethoxycarbonyl-4-nitro-3-phenylbutanoate |
| SMILES | CCOC(=O)C(C(=O)[O-])C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C13H15NO6/c1-2-20-13(17)11(12(15)16)10(8-14(18)19)9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3,(H,15,16)/p-1 |
| InChIKey | YXFFBHDBSVRNGH-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|