C20H29NO6 — CID 86177391
diethyl 2-(5-methyl-5-nitro-1-phenylhexyl)propanedioate (PubChem CID 86177391) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is diethyl 2-(5-methyl-5-nitro-1-phenylhexyl)propanedioate.
| Compound Name | diethyl 2-(5-methyl-5-nitro-1-phenylhexyl)propanedioate |
|---|---|
| PubChem CID | 86177391 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | diethyl 2-(5-methyl-5-nitro-1-phenylhexyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CCCC(C)(C)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H29NO6/c1-5-26-18(22)17(19(23)27-6-2)16(15-11-8-7-9-12-15)13-10-14-20(3,4)21(24)25/h7-9,11-12,16-17H,5-6,10,13-14H2,1-4H3 |
| InChIKey | SNWHEHHFAXOFJQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|