About 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate
1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate (PubChem CID 139256375) has the molecular formula C23H25NO7
and a molecular weight of 427.45 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate |
| PubChem CID | 139256375 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate |
| SMILES | CCOC(=O)C(C(=O)c1ccccc1)C(c1ccccc1)C(CC[N+](=O)[O-])C(=O)OC |
| InChI | InChI=1S/C23H25NO7/c1-3-31-23(27)20(21(25)17-12-8-5-9-13-17)19(16-10-6-4-7-11-16)18(22(26)30-2)14-15-24(28)29/h4-13,18-20H,3,14-15H2,1-2H3 |
| InChIKey | ICZQGKIBMLPHOS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate (CID 139256375) is 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate is CCOC(=O)C(C(=O)c1ccccc1)C(c1ccccc1)C(CC[N+](=O)[O-])C(=O)OC.
What is the InChIKey of 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate?
The InChIKey is ICZQGKIBMLPHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO7/c1-3-31-23(27)20(21(25)17-12-8-5-9-13-17)19(16-10-6-4-7-11-16)18(22(26)30-2)14-15-24(28)29/h4-13,18-20H,3,14-15H2,1-2H3.
What are the key properties of 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate?
1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate has a molecular weight of 427.45 g/mol, XLogP of 3.29, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl 2-benzoyl-4-(2-nitroethyl)-3-phenylpentanedioate is sourced from PubChem (CID 139256375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).