C28H26O4 — CID 134842010
ethyl (Z,3R)-2-benzoyl-4-oxo-3,6-diphenylhept-5-enoate (PubChem CID 134842010) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl (Z,3R)-2-benzoyl-4-oxo-3,6-diphenylhept-5-enoate.
| Compound Name | ethyl (Z,3R)-2-benzoyl-4-oxo-3,6-diphenylhept-5-enoate |
|---|---|
| PubChem CID | 134842010 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl (Z,3R)-2-benzoyl-4-oxo-3,6-diphenylhept-5-enoate |
| SMILES | CCOC(=O)C(C(=O)c1ccccc1)[C@@H](C(=O)/C=C(/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26O4/c1-3-32-28(31)26(27(30)23-17-11-6-12-18-23)25(22-15-9-5-10-16-22)24(29)19-20(2)21-13-7-4-8-14-21/h4-19,25-26H,3H2,1-2H3/b20-19-/t25-,26?/m1/s1 |
| InChIKey | KVYVDQOYIDWGDW-WDVKWTBSSA-N |
| XLogP | 5.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|