C14H15Cl3N2O4 — CID 102170302
ethyl 2-benzoyl-3-(carbamoylamino)-4,4,4-trichlorobutanoate (PubChem CID 102170302) has the molecular formula C14H15Cl3N2O4 and a molecular weight of 381.64 g/mol. Its IUPAC name is ethyl 2-benzoyl-3-(carbamoylamino)-4,4,4-trichlorobutanoate.
| Compound Name | ethyl 2-benzoyl-3-(carbamoylamino)-4,4,4-trichlorobutanoate |
|---|---|
| PubChem CID | 102170302 |
| Molecular Formula | C14H15Cl3N2O4 |
| Molecular Weight | 381.64 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | ethyl 2-benzoyl-3-(carbamoylamino)-4,4,4-trichlorobutanoate |
| SMILES | CCOC(=O)C(C(=O)c1ccccc1)C(NC(N)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H15Cl3N2O4/c1-2-23-12(21)9(10(20)8-6-4-3-5-7-8)11(14(15,16)17)19-13(18)22/h3-7,9,11H,2H2,1H3,(H3,18,19,22) |
| InChIKey | BUUFZMGZHKBEES-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|