C11H16Cl3NO6 — CID 2777984
diethyl 2-[2,2,2-trichloro-1-(methoxycarbonylamino)ethyl]propanedioate (PubChem CID 2777984) has the molecular formula C11H16Cl3NO6 and a molecular weight of 364.61 g/mol. Its IUPAC name is diethyl 2-[2,2,2-trichloro-1-(methoxycarbonylamino)ethyl]propanedioate.
| Compound Name | diethyl 2-[2,2,2-trichloro-1-(methoxycarbonylamino)ethyl]propanedioate |
|---|---|
| PubChem CID | 2777984 |
| Molecular Formula | C11H16Cl3NO6 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | diethyl 2-[2,2,2-trichloro-1-(methoxycarbonylamino)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(NC(=O)OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO6/c1-4-20-8(16)6(9(17)21-5-2)7(11(12,13)14)15-10(18)19-3/h6-7H,4-5H2,1-3H3,(H,15,18) |
| InChIKey | SNCKPYPSYRJYTP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|