C8H10Cl3NO4 — CID 2313183
ethyl (2R)-2-acetamido-4,4,4-trichloro-3-oxobutanoate (PubChem CID 2313183) has the molecular formula C8H10Cl3NO4 and a molecular weight of 290.53 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-4,4,4-trichloro-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-acetamido-4,4,4-trichloro-3-oxobutanoate |
|---|---|
| PubChem CID | 2313183 |
| Molecular Formula | C8H10Cl3NO4 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | ethyl (2R)-2-acetamido-4,4,4-trichloro-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](NC(C)=O)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl3NO4/c1-3-16-7(15)5(12-4(2)13)6(14)8(9,10)11/h5H,3H2,1-2H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | SXFIAPZTWWQEQA-RXMQYKEDSA-N |
| XLogP | 0.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|