C12H21NO5 — CID 43423034
diethyl 2-(2,2-dimethylpropanoylamino)propanedioate (PubChem CID 43423034) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is diethyl 2-(2,2-dimethylpropanoylamino)propanedioate.
| Compound Name | diethyl 2-(2,2-dimethylpropanoylamino)propanedioate |
|---|---|
| PubChem CID | 43423034 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | diethyl 2-(2,2-dimethylpropanoylamino)propanedioate |
| SMILES | CCOC(=O)C(NC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C12H21NO5/c1-6-17-9(14)8(10(15)18-7-2)13-11(16)12(3,4)5/h8H,6-7H2,1-5H3,(H,13,16) |
| InChIKey | LLIUAZUALSWHQY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|