C12H19NO3 — CID 12071981
ethyl 2-(2,2-dimethylpropanoylamino)pent-4-ynoate (PubChem CID 12071981) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethylpropanoylamino)pent-4-ynoate.
| Compound Name | ethyl 2-(2,2-dimethylpropanoylamino)pent-4-ynoate |
|---|---|
| PubChem CID | 12071981 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethyl 2-(2,2-dimethylpropanoylamino)pent-4-ynoate |
| SMILES | C#CCC(NC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C12H19NO3/c1-6-8-9(10(14)16-7-2)13-11(15)12(3,4)5/h1,9H,7-8H2,2-5H3,(H,13,15) |
| InChIKey | RMBNJFROUAXQDQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|