C11H14F3NO3 — CID 132992553
tert-butyl (2R)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoate (PubChem CID 132992553) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoate.
| Compound Name | tert-butyl (2R)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoate |
|---|---|
| PubChem CID | 132992553 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | tert-butyl (2R)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-ynoate |
| SMILES | C#CC[C@@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H14F3NO3/c1-5-6-7(8(16)18-10(2,3)4)15-9(17)11(12,13)14/h1,7H,6H2,2-4H3,(H,15,17)/t7-/m1/s1 |
| InChIKey | JFMMECDRWPMDHQ-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|