C18H29F3N2O4 — CID 101431905
tert-butyl (2R)-4-methyl-2-[[(2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]pent-4-enoate (PubChem CID 101431905) has the molecular formula C18H29F3N2O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is tert-butyl (2R)-4-methyl-2-[[(2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]pent-4-enoate.
| Compound Name | tert-butyl (2R)-4-methyl-2-[[(2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 101431905 |
| Molecular Formula | C18H29F3N2O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl (2R)-4-methyl-2-[[(2S)-4-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoyl]amino]pent-4-enoate |
| SMILES | C=C(C)C[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29F3N2O4/c1-10(2)8-12(23-16(26)18(19,20)21)14(24)22-13(9-11(3)4)15(25)27-17(5,6)7/h10,12-13H,3,8-9H2,1-2,4-7H3,(H,22,24)(H,23,26)/t12-,13+/m0/s1 |
| InChIKey | OEKDEGVLXNQOOU-QWHCGFSZSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|