C28H39F3N2O4 — CID 16752840
tert-butyl (2R)-5,9-dimethyl-4-methylidene-2-[[(2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]dec-8-enoate (PubChem CID 16752840) has the molecular formula C28H39F3N2O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl (2R)-5,9-dimethyl-4-methylidene-2-[[(2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]dec-8-enoate.
| Compound Name | tert-butyl (2R)-5,9-dimethyl-4-methylidene-2-[[(2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]dec-8-enoate |
|---|---|
| PubChem CID | 16752840 |
| Molecular Formula | C28H39F3N2O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | tert-butyl (2R)-5,9-dimethyl-4-methylidene-2-[[(2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]dec-8-enoate |
| SMILES | C=C(C[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)C(C)CCC=C(C)C |
| InChI | InChI=1S/C28H39F3N2O4/c1-18(2)12-11-13-19(3)20(4)16-23(25(35)37-27(5,6)7)32-24(34)22(33-26(36)28(29,30)31)17-21-14-9-8-10-15-21/h8-10,12,14-15,19,22-23H,4,11,13,16-17H2,1-3,5-7H3,(H,32,34)(H,33,36)/t19?,22-,23+/m0/s1 |
| InChIKey | ZXXSVAYISHZTNG-NWZLQDFTSA-N |
| XLogP | 5.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|