C13H23NO3 — CID 85256183
tert-butyl 4-methyl-2-(prop-2-enoylamino)pentanoate (PubChem CID 85256183) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl 4-methyl-2-(prop-2-enoylamino)pentanoate.
| Compound Name | tert-butyl 4-methyl-2-(prop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 85256183 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl 4-methyl-2-(prop-2-enoylamino)pentanoate |
| SMILES | C=CC(=O)NC(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-7-11(15)14-10(8-9(2)3)12(16)17-13(4,5)6/h7,9-10H,1,8H2,2-6H3,(H,14,15) |
| InChIKey | JLTGBOLAGDUTPO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|