C12H19NO4 — CID 88894718
2-oxopropyl 4-methyl-2-(prop-2-enoylamino)pentanoate (PubChem CID 88894718) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-oxopropyl 4-methyl-2-(prop-2-enoylamino)pentanoate.
| Compound Name | 2-oxopropyl 4-methyl-2-(prop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 88894718 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-oxopropyl 4-methyl-2-(prop-2-enoylamino)pentanoate |
| SMILES | C=CC(=O)NC(CC(C)C)C(=O)OCC(C)=O |
| InChI | InChI=1S/C12H19NO4/c1-5-11(15)13-10(6-8(2)3)12(16)17-7-9(4)14/h5,8,10H,1,6-7H2,2-4H3,(H,13,15) |
| InChIKey | GEBJYLADDUUZAP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|