About diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride
diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride (PubChem CID 159088657) has the molecular formula C16H29ClN2O9
and a molecular weight of 428.87 g/mol. Its IUPAC name is diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride.
Molecular Properties
| Compound Name | diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride |
| PubChem CID | 159088657 |
| Molecular Formula | C16H29ClN2O9 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride |
| SMILES | CCOC(=O)C(N)C(=O)OCC.CCOC(=O)C(NC(C)=O)C(=O)OCC.Cl |
| InChI | InChI=1S/C9H15NO5.C7H13NO4.ClH/c1-4-14-8(12)7(10-6(3)11)9(13)15-5-2;1-3-11-6(9)5(8)7(10)12-4-2;/h7H,4-5H2,1-3H3,(H,10,11);5H,3-4,8H2,1-2H3;1H |
| InChIKey | KBTVUGFJMOXEBN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride?
The IUPAC name of diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride (CID 159088657) is diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride.
What is the SMILES notation for diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride?
The canonical SMILES for diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride is CCOC(=O)C(N)C(=O)OCC.CCOC(=O)C(NC(C)=O)C(=O)OCC.Cl.
What is the InChIKey of diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride?
The InChIKey is KBTVUGFJMOXEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO5.C7H13NO4.ClH/c1-4-14-8(12)7(10-6(3)11)9(13)15-5-2;1-3-11-6(9)5(8)7(10)12-4-2;/h7H,4-5H2,1-3H3,(H,10,11);5H,3-4,8H2,1-2H3;1H.
What are the key properties of diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride?
diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride has a molecular weight of 428.87 g/mol, XLogP of -0.52, 9 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetamidopropanedioate;diethyl 2-aminopropanedioate;hydrochloride is sourced from PubChem (CID 159088657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).