C12H23ClN2O5 — CID 120559501
diethyl 2-(4-aminopentanoylamino)propanedioate;hydrochloride (PubChem CID 120559501) has the molecular formula C12H23ClN2O5 and a molecular weight of 310.78 g/mol. Its IUPAC name is diethyl 2-(4-aminopentanoylamino)propanedioate;hydrochloride.
| Compound Name | diethyl 2-(4-aminopentanoylamino)propanedioate;hydrochloride |
|---|---|
| PubChem CID | 120559501 |
| Molecular Formula | C12H23ClN2O5 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | diethyl 2-(4-aminopentanoylamino)propanedioate;hydrochloride |
| SMILES | CCOC(=O)C(NC(=O)CCC(C)N)C(=O)OCC.Cl |
| InChI | InChI=1S/C12H22N2O5.ClH/c1-4-18-11(16)10(12(17)19-5-2)14-9(15)7-6-8(3)13;/h8,10H,4-7,13H2,1-3H3,(H,14,15);1H |
| InChIKey | UWANCHRTYBOEQN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|