C13H29ClN2O — CID 120563103
4-amino-N-(5,5-dimethylhexan-2-yl)pentanamide;hydrochloride (PubChem CID 120563103) has the molecular formula C13H29ClN2O and a molecular weight of 264.84 g/mol. Its IUPAC name is 4-amino-N-(5,5-dimethylhexan-2-yl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(5,5-dimethylhexan-2-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120563103 |
| Molecular Formula | C13H29ClN2O |
| Molecular Weight | 264.84 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-amino-N-(5,5-dimethylhexan-2-yl)pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NC(C)CCC(C)(C)C.Cl |
| InChI | InChI=1S/C13H28N2O.ClH/c1-10(14)6-7-12(16)15-11(2)8-9-13(3,4)5;/h10-11H,6-9,14H2,1-5H3,(H,15,16);1H |
| InChIKey | CCWKXSUVCVNYIC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |