C14H30N2O — CID 119796588
(2S)-2-amino-N-(5,5-dimethylhexan-2-yl)-4-methylpentanamide (PubChem CID 119796588) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is (2S)-2-amino-N-(5,5-dimethylhexan-2-yl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(5,5-dimethylhexan-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 119796588 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | (2S)-2-amino-N-(5,5-dimethylhexan-2-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NC(C)CCC(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-10(2)9-12(15)13(17)16-11(3)7-8-14(4,5)6/h10-12H,7-9,15H2,1-6H3,(H,16,17)/t11?,12-/m0/s1 |
| InChIKey | SRQZPEMSWRQNDV-KIYNQFGBSA-N |
| XLogP | 2.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |