C12H24N2O3 — CID 104903890
5-[[(2R)-2-amino-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 104903890) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 5-[[(2R)-2-amino-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 5-[[(2R)-2-amino-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 104903890 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 5-[[(2R)-2-amino-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)C[C@@H](N)C(=O)NC(C)CCCC(=O)O |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)7-10(13)12(17)14-9(3)5-4-6-11(15)16/h8-10H,4-7,13H2,1-3H3,(H,14,17)(H,15,16)/t9?,10-/m1/s1 |
| InChIKey | QUJFJWKECPLEFV-QVDQXJPCSA-N |
| XLogP | 1.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |