C7H9Cl3O4 — CID 174430485
4,4,4-trichloro-3-ethoxycarbonylbutanoic acid (PubChem CID 174430485) has the molecular formula C7H9Cl3O4 and a molecular weight of 263.50 g/mol. Its IUPAC name is 4,4,4-trichloro-3-ethoxycarbonylbutanoic acid.
| Compound Name | 4,4,4-trichloro-3-ethoxycarbonylbutanoic acid |
|---|---|
| PubChem CID | 174430485 |
| Molecular Formula | C7H9Cl3O4 |
| Molecular Weight | 263.50 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 4,4,4-trichloro-3-ethoxycarbonylbutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9Cl3O4/c1-2-14-6(13)4(3-5(11)12)7(8,9)10/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | IUBJWQVZGYRMPH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|